C16H20F2N2O3 — CID 156899565
(2S)-N-[(E)-4-aminobut-2-enyl]-3-(3,3-difluoro-1H-2-benzofuran-5-yl)-2-methoxypropanamide (PubChem CID 156899565) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is (2S)-N-[(E)-4-aminobut-2-enyl]-3-(3,3-difluoro-1H-2-benzofuran-5-yl)-2-methoxypropanamide.
| Compound Name | (2S)-N-[(E)-4-aminobut-2-enyl]-3-(3,3-difluoro-1H-2-benzofuran-5-yl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 156899565 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2S)-N-[(E)-4-aminobut-2-enyl]-3-(3,3-difluoro-1H-2-benzofuran-5-yl)-2-methoxypropanamide |
| SMILES | CO[C@@H](Cc1ccc2c(c1)C(F)(F)OC2)C(=O)NC/C=C/CN |
| InChI | InChI=1S/C16H20F2N2O3/c1-22-14(15(21)20-7-3-2-6-19)9-11-4-5-12-10-23-16(17,18)13(12)8-11/h2-5,8,14H,6-7,9-10,19H2,1H3,(H,20,21)/b3-2+/t14-/m0/s1 |
| InChIKey | DIHHJHYZQKXMPA-HSWBROFVSA-N |
| XLogP | 1.45 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|