C33H57NO3Si — CID 101419341
(4R,5S)-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one (PubChem CID 101419341) has the molecular formula C33H57NO3Si and a molecular weight of 543.91 g/mol. Its IUPAC name is (4R,5S)-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one.
| Compound Name | (4R,5S)-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 101419341 |
| Molecular Formula | C33H57NO3Si |
| Molecular Weight | 543.91 g/mol |
| Exact Mass | 543.41 |
| IUPAC Name | (4R,5S)-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one |
| SMILES | C=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1NC(=O)C[C@H]1OC(C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C33H57NO3Si/c1-15-29(37-38(22(8)9,23(10)11)24(12)13)33-30(18-31(35)34-33)36-25(14)32-27(20(4)5)16-26(19(2)3)17-28(32)21(6)7/h15-17,19-25,29-30,33H,1,18H2,2-14H3,(H,34,35)/t25?,29-,30-,33-/m1/s1 |
| InChIKey | LRQJMHMTSUFYAG-APJPXATOSA-N |
| XLogP | 9.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.91 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|