C25H41NO3 — CID 10905530
(4R,5S)-5-(4-hydroxybutyl)-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 10905530) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is (4R,5S)-5-(4-hydroxybutyl)-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4R,5S)-5-(4-hydroxybutyl)-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10905530 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | (4R,5S)-5-(4-hydroxybutyl)-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | CC(C)c1cc(C(C)C)c([C@H](C)O[C@@H]2CC(=O)N[C@H]2CCCCO)c(C(C)C)c1 |
| InChI | InChI=1S/C25H41NO3/c1-15(2)19-12-20(16(3)4)25(21(13-19)17(5)6)18(7)29-23-14-24(28)26-22(23)10-8-9-11-27/h12-13,15-18,22-23,27H,8-11,14H2,1-7H3,(H,26,28)/t18-,22-,23+/m0/s1 |
| InChIKey | YPECLNMCDNUMOP-OFAXGOBFSA-N |
| XLogP | 5.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|