C33H49NO2Si — CID 24851429
(5S,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 24851429) has the molecular formula C33H49NO2Si and a molecular weight of 519.85 g/mol. Its IUPAC name is (5S,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5S,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 24851429 |
| Molecular Formula | C33H49NO2Si |
| Molecular Weight | 519.85 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | (5S,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)c1cc(C(C)C)c([C@H](C)O[C@@H]2C[C@@H](C[Si](C)(C)c3ccccc3)N3C(=O)CC[C@H]23)c(C(C)C)c1 |
| InChI | InChI=1S/C33H49NO2Si/c1-21(2)25-17-28(22(3)4)33(29(18-25)23(5)6)24(7)36-31-19-26(34-30(31)15-16-32(34)35)20-37(8,9)27-13-11-10-12-14-27/h10-14,17-18,21-24,26,30-31H,15-16,19-20H2,1-9H3/t24-,26-,30+,31+/m0/s1 |
| InChIKey | VBYDLYSTGUACHB-CBVMVLCFSA-N |
| XLogP | 7.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.85 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|