C25H29NO3Si — CID 10788229
[(S)-[(2S)-5-oxo-1-(trimethylsilylmethyl)pyrrolidin-2-yl]-phenanthren-9-ylmethyl] acetate (PubChem CID 10788229) has the molecular formula C25H29NO3Si and a molecular weight of 419.60 g/mol. Its IUPAC name is [(S)-[(2S)-5-oxo-1-(trimethylsilylmethyl)pyrrolidin-2-yl]-phenanthren-9-ylmethyl] acetate.
| Compound Name | [(S)-[(2S)-5-oxo-1-(trimethylsilylmethyl)pyrrolidin-2-yl]-phenanthren-9-ylmethyl] acetate |
|---|---|
| PubChem CID | 10788229 |
| Molecular Formula | C25H29NO3Si |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [(S)-[(2S)-5-oxo-1-(trimethylsilylmethyl)pyrrolidin-2-yl]-phenanthren-9-ylmethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1cc2ccccc2c2ccccc12)[C@@H]1CCC(=O)N1C[Si](C)(C)C |
| InChI | InChI=1S/C25H29NO3Si/c1-17(27)29-25(23-13-14-24(28)26(23)16-30(2,3)4)22-15-18-9-5-6-10-19(18)20-11-7-8-12-21(20)22/h5-12,15,23,25H,13-14,16H2,1-4H3/t23-,25-/m0/s1 |
| InChIKey | PANJNWUUXAFJRM-ZCYQVOJMSA-N |
| XLogP | 5.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|