C24H27NO4 — CID 162405561
1-O-benzyl 2-O-methyl (2R,3S)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-1,2-dicarboxylate (PubChem CID 162405561) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2R,3S)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2R,3S)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 162405561 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2R,3S)-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccc3c(c2)CCCC3)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO4/c1-28-23(26)22-21(20-12-11-18-9-5-6-10-19(18)15-20)13-14-25(22)24(27)29-16-17-7-3-2-4-8-17/h2-4,7-8,11-12,15,21-22H,5-6,9-10,13-14,16H2,1H3/t21-,22+/m0/s1 |
| InChIKey | XYQKXFVOFDQHDM-FCHUYYIVSA-N |
| XLogP | 4.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |