About (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate
(3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate (PubChem CID 10429546) has the molecular formula C24H25NO3
and a molecular weight of 375.47 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate.
Molecular Properties
| Compound Name | (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate |
| PubChem CID | 10429546 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate |
| SMILES | CC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)OCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H25NO3/c1-16-10-17(2)12-20(11-16)15-28-24(27)23(25-18(3)26)14-19-8-9-21-6-4-5-7-22(21)13-19/h4-13,23H,14-15H2,1-3H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | YJJKIQVHZFHYRR-QHCPKHFHSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate?
The IUPAC name of (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate (CID 10429546) is (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate.
What is the SMILES notation for (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate?
The canonical SMILES for (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate is CC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)OCc1cc(C)cc(C)c1.
What is the InChIKey of (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate?
The InChIKey is YJJKIQVHZFHYRR-QHCPKHFHSA-N. The full InChI is InChI=1S/C24H25NO3/c1-16-10-17(2)12-20(11-16)15-28-24(27)23(25-18(3)26)14-19-8-9-21-6-4-5-7-22(21)13-19/h4-13,23H,14-15H2,1-3H3,(H,25,26)/t23-/m0/s1.
What are the key properties of (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate?
(3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate has a molecular weight of 375.47 g/mol, XLogP of 4.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate is sourced from PubChem (CID 10429546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).