C27H33BN2O5 — CID 44582997
[(1R)-3-methyl-1-[[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]butyl]boronic acid (PubChem CID 44582997) has the molecular formula C27H33BN2O5 and a molecular weight of 476.38 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 44582997 |
| Molecular Formula | C27H33BN2O5 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)N(C)C(=O)OCc1ccccc1)B(O)O |
| InChI | InChI=1S/C27H33BN2O5/c1-19(2)16-25(28(33)34)29-26(31)24(17-22-14-9-13-21-12-7-8-15-23(21)22)30(3)27(32)35-18-20-10-5-4-6-11-20/h4-15,19,24-25,33-34H,16-18H2,1-3H3,(H,29,31)/t24-,25-/m0/s1 |
| InChIKey | MHKWVAKGEAIJFL-DQEYMECFSA-N |
| XLogP | 3.56 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|