C24H25NO3 — CID 10045010
(3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-1-ylpropanoate (PubChem CID 10045010) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-1-ylpropanoate.
| Compound Name | (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 10045010 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (3,5-dimethylphenyl)methyl (2S)-2-acetamido-3-naphthalen-1-ylpropanoate |
| SMILES | CC(=O)N[C@@H](Cc1cccc2ccccc12)C(=O)OCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H25NO3/c1-16-11-17(2)13-19(12-16)15-28-24(27)23(25-18(3)26)14-21-9-6-8-20-7-4-5-10-22(20)21/h4-13,23H,14-15H2,1-3H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | JVGLPNAFXMQTND-QHCPKHFHSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |