C20H21N — CID 63527361
1-(3,5-dimethylphenyl)-2-naphthalen-1-ylethanamine (PubChem CID 63527361) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-naphthalen-1-ylethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 63527361 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-naphthalen-1-ylethanamine |
| SMILES | Cc1cc(C)cc(C(N)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C20H21N/c1-14-10-15(2)12-18(11-14)20(21)13-17-8-5-7-16-6-3-4-9-19(16)17/h3-12,20H,13,21H2,1-2H3 |
| InChIKey | OPNBCRAWENFABJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |