C33H45NO4 — CID 10506138
benzyl (2S,3S)-2-but-3-enyl-5-oxo-3-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate (PubChem CID 10506138) has the molecular formula C33H45NO4 and a molecular weight of 519.73 g/mol. Its IUPAC name is benzyl (2S,3S)-2-but-3-enyl-5-oxo-3-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-2-but-3-enyl-5-oxo-3-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10506138 |
| Molecular Formula | C33H45NO4 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | benzyl (2S,3S)-2-but-3-enyl-5-oxo-3-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate |
| SMILES | C=CCC[C@H]1[C@@H](O[C@H](C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H45NO4/c1-9-10-16-29-30(19-31(35)34(29)33(36)37-20-25-14-12-11-13-15-25)38-24(8)32-27(22(4)5)17-26(21(2)3)18-28(32)23(6)7/h9,11-15,17-18,21-24,29-30H,1,10,16,19-20H2,2-8H3/t24-,29+,30+/m1/s1 |
| InChIKey | JJHRSZIFTQLPOG-FRDKBHKLSA-N |
| XLogP | 8.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|