C37H41NO4Si — CID 57325792
(1S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 57325792) has the molecular formula C37H41NO4Si and a molecular weight of 591.82 g/mol. Its IUPAC name is (1S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 57325792 |
| Molecular Formula | C37H41NO4Si |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (1S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1CC(=O)N2[C@H]1[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]2COCc1ccccc1 |
| InChI | InChI=1S/C37H41NO4Si/c1-43(2,31-21-13-6-14-22-31)33-23-34(39)38-32(27-40-24-28-15-7-3-8-16-28)36(41-25-29-17-9-4-10-18-29)37(35(33)38)42-26-30-19-11-5-12-20-30/h3-22,32-33,35-37H,23-27H2,1-2H3/t32-,33+,35-,36-,37-/m1/s1 |
| InChIKey | SVFILCDLEHPLOR-VSNXSOFLSA-N |
| XLogP | 6.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|