C40H45NO5Si — CID 10794287
(5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]-5-(1,3-dioxolan-2-yl)pentanoyl]-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 10794287) has the molecular formula C40H45NO5Si and a molecular weight of 647.89 g/mol. Its IUPAC name is (5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]-5-(1,3-dioxolan-2-yl)pentanoyl]-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]-5-(1,3-dioxolan-2-yl)pentanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10794287 |
| Molecular Formula | C40H45NO5Si |
| Molecular Weight | 647.89 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | (5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]-5-(1,3-dioxolan-2-yl)pentanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | C[Si](C)(c1ccccc1)[C@@H](CCC1OCCO1)CC(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H45NO5Si/c1-47(2,35-21-13-6-14-22-35)36(24-26-39-44-27-28-45-39)29-38(43)41-34(23-25-37(41)42)30-46-40(31-15-7-3-8-16-31,32-17-9-4-10-18-32)33-19-11-5-12-20-33/h3-22,34,36,39H,23-30H2,1-2H3/t34-,36-/m0/s1 |
| InChIKey | YXVAASQHCWEFHU-GIWKVKTRSA-N |
| XLogP | 7.04 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.89 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|