C31H37NO3Si — CID 10625185
(5S)-1-[(3R)-3-trimethylsilylbutanoyl]-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 10625185) has the molecular formula C31H37NO3Si and a molecular weight of 499.73 g/mol. Its IUPAC name is (5S)-1-[(3R)-3-trimethylsilylbutanoyl]-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[(3R)-3-trimethylsilylbutanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10625185 |
| Molecular Formula | C31H37NO3Si |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (5S)-1-[(3R)-3-trimethylsilylbutanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | C[C@H](CC(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C31H37NO3Si/c1-24(36(2,3)4)22-30(34)32-28(20-21-29(32)33)23-35-31(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,24,28H,20-23H2,1-4H3/t24-,28+/m1/s1 |
| InChIKey | RFGUYDRNZSQXFN-YWEHKCAJSA-N |
| XLogP | 6.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|