C31H33NO3 — CID 10994288
(5S)-1-[(E)-hept-2-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 10994288) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is (5S)-1-[(E)-hept-2-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[(E)-hept-2-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10994288 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (5S)-1-[(E)-hept-2-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | CCCC/C=C/C(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33NO3/c1-2-3-4-14-21-29(33)32-28(22-23-30(32)34)24-35-31(25-15-8-5-9-16-25,26-17-10-6-11-18-26)27-19-12-7-13-20-27/h5-21,28H,2-4,22-24H2,1H3/b21-14+/t28-/m0/s1 |
| InChIKey | HFIDZOJMSNCNRL-BSKIJULFSA-N |
| XLogP | 6.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|