C39H43NO3Si — CID 10841302
(5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]hept-6-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 10841302) has the molecular formula C39H43NO3Si and a molecular weight of 601.86 g/mol. Its IUPAC name is (5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]hept-6-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]hept-6-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10841302 |
| Molecular Formula | C39H43NO3Si |
| Molecular Weight | 601.86 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | (5S)-1-[(3S)-3-[dimethyl(phenyl)silyl]hept-6-enoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | C=CCC[C@@H](CC(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C39H43NO3Si/c1-4-5-24-36(44(2,3)35-25-16-9-17-26-35)29-38(42)40-34(27-28-37(40)41)30-43-39(31-18-10-6-11-19-31,32-20-12-7-13-21-32)33-22-14-8-15-23-33/h4,6-23,25-26,34,36H,1,5,24,27-30H2,2-3H3/t34-,36-/m0/s1 |
| InChIKey | QBXRBTWAGJNEFV-GIWKVKTRSA-N |
| XLogP | 7.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.86 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|