C32H33NO4 — CID 135019673
(1S,2R,3S,8aS,8bS)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one (PubChem CID 135019673) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is (1S,2R,3S,8aS,8bS)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one.
| Compound Name | (1S,2R,3S,8aS,8bS)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one |
|---|---|
| PubChem CID | 135019673 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (1S,2R,3S,8aS,8bS)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one |
| SMILES | O=C1C=C2CN3[C@H]([C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@@H]3COCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C32H33NO4/c34-27-16-26-18-33-29(22-35-19-23-10-4-1-5-11-23)31(36-20-24-12-6-2-7-13-24)32(30(33)28(26)17-27)37-21-25-14-8-3-9-15-25/h1-16,28-32H,17-22H2/t28-,29-,30-,31+,32-/m0/s1 |
| InChIKey | USOVEOMMEIIDCZ-NRQMHRBESA-N |
| XLogP | 4.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |