C24H25NO3 — CID 135019676
(1S,2S,8aS,8bS)-1,2-bis(phenylmethoxy)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one (PubChem CID 135019676) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1S,2S,8aS,8bS)-1,2-bis(phenylmethoxy)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one.
| Compound Name | (1S,2S,8aS,8bS)-1,2-bis(phenylmethoxy)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one |
|---|---|
| PubChem CID | 135019676 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (1S,2S,8aS,8bS)-1,2-bis(phenylmethoxy)-2,3,5,8,8a,8b-hexahydro-1H-cyclopenta[a]pyrrolizin-7-one |
| SMILES | O=C1C=C2CN3C[C@H](OCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]3[C@H]2C1 |
| InChI | InChI=1S/C24H25NO3/c26-20-11-19-13-25-14-22(27-15-17-7-3-1-4-8-17)24(23(25)21(19)12-20)28-16-18-9-5-2-6-10-18/h1-11,21-24H,12-16H2/t21-,22-,23-,24+/m0/s1 |
| InChIKey | OIZOCSRDNPJZQX-NEWJYFPISA-N |
| XLogP | 3.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |