C29H31NO4 — CID 11305648
[(1R,2R,3S,8R)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate (PubChem CID 11305648) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is [(1R,2R,3S,8R)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate.
| Compound Name | [(1R,2R,3S,8R)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 11305648 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [(1R,2R,3S,8R)-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2CCCN21)c1ccccc1 |
| InChI | InChI=1S/C29H31NO4/c31-29(24-15-8-3-9-16-24)34-21-26-28(33-20-23-13-6-2-7-14-23)27(25-17-10-18-30(25)26)32-19-22-11-4-1-5-12-22/h1-9,11-16,25-28H,10,17-21H2/t25-,26+,27-,28-/m1/s1 |
| InChIKey | JWCISRGLEBSBBI-JUDWXZBOSA-N |
| XLogP | 4.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |