C29H31NO4 — CID 11213263
(5R,6R,7R,8R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11213263) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is (5R,6R,7R,8R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5R,6R,7R,8R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11213263 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (5R,6R,7R,8R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1CC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C29H31NO4/c31-27-17-16-25-28(33-19-23-12-6-2-7-13-23)29(34-20-24-14-8-3-9-15-24)26(30(25)27)21-32-18-22-10-4-1-5-11-22/h1-15,25-26,28-29H,16-21H2/t25-,26-,28-,29-/m1/s1 |
| InChIKey | IYSRIAPJIXBCQR-BOXYVWFNSA-N |
| XLogP | 4.75 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |