C30H35NO4 — CID 135013550
(1S,2S,3S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium (PubChem CID 135013550) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium.
| Compound Name | (1S,2S,3S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
|---|---|
| PubChem CID | 135013550 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (1S,2S,3S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
| SMILES | C[C@@H]1CC[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)[N@@+]12[O-] |
| InChI | InChI=1S/C30H35NO4/c1-23-17-18-27-29(34-20-25-13-7-3-8-14-25)30(35-21-26-15-9-4-10-16-26)28(31(23,27)32)22-33-19-24-11-5-2-6-12-24/h2-16,23,27-30H,17-22H2,1H3/t23-,27+,28+,29+,30+,31-/m1/s1 |
| InChIKey | OQTIERRRTPNORN-MTSZOBLRSA-N |
| XLogP | 5.62 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|