C34H41NO6 — CID 135015652
tert-butyl (2S,3S,4S,5S)-2-(3-oxopropyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 135015652) has the molecular formula C34H41NO6 and a molecular weight of 559.70 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S,5S)-2-(3-oxopropyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S,5S)-2-(3-oxopropyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135015652 |
| Molecular Formula | C34H41NO6 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | tert-butyl (2S,3S,4S,5S)-2-(3-oxopropyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCC=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C34H41NO6/c1-34(2,3)41-33(37)35-29(20-13-21-36)31(39-23-27-16-9-5-10-17-27)32(40-24-28-18-11-6-12-19-28)30(35)25-38-22-26-14-7-4-8-15-26/h4-12,14-19,21,29-32H,13,20,22-25H2,1-3H3/t29-,30-,31-,32-/m0/s1 |
| InChIKey | ACJNPIBJCILWLS-YDPTYEFTSA-N |
| XLogP | 6.34 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|