C33H37NO6 — CID 11584728
diethyl 2-[(2S,5S)-1-acetyl-5-(trityloxymethyl)pyrrolidin-2-yl]propanedioate (PubChem CID 11584728) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is diethyl 2-[(2S,5S)-1-acetyl-5-(trityloxymethyl)pyrrolidin-2-yl]propanedioate.
| Compound Name | diethyl 2-[(2S,5S)-1-acetyl-5-(trityloxymethyl)pyrrolidin-2-yl]propanedioate |
|---|---|
| PubChem CID | 11584728 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | diethyl 2-[(2S,5S)-1-acetyl-5-(trityloxymethyl)pyrrolidin-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CC[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)N1C(C)=O |
| InChI | InChI=1S/C33H37NO6/c1-4-38-31(36)30(32(37)39-5-2)29-22-21-28(34(29)24(3)35)23-40-33(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,28-30H,4-5,21-23H2,1-3H3/t28-,29-/m0/s1 |
| InChIKey | IPZVEMZRISUCDR-VMPREFPWSA-N |
| XLogP | 5.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|