C36H45NO5 — CID 134847061
tert-butyl N-but-3-enyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate (PubChem CID 134847061) has the molecular formula C36H45NO5 and a molecular weight of 571.76 g/mol. Its IUPAC name is tert-butyl N-but-3-enyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-but-3-enyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134847061 |
| Molecular Formula | C36H45NO5 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | tert-butyl N-but-3-enyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate |
| SMILES | C=CCCN(C(=O)OC(C)(C)C)[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C36H45NO5/c1-6-8-24-37(35(38)42-36(3,4)5)32(28-39-25-29-18-12-9-13-19-29)34(41-27-31-22-16-11-17-23-31)33(7-2)40-26-30-20-14-10-15-21-30/h6-7,9-23,32-34H,1-2,8,24-28H2,3-5H3/t32-,33-,34-/m1/s1 |
| InChIKey | GKDHDGWWLVIWCZ-CKOYEXALSA-N |
| XLogP | 7.74 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|