C30H33NO4 — CID 11420043
[(1R,2R,3S,5R,8R)-5-methyl-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate (PubChem CID 11420043) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is [(1R,2R,3S,5R,8R)-5-methyl-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate.
| Compound Name | [(1R,2R,3S,5R,8R)-5-methyl-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 11420043 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [(1R,2R,3S,5R,8R)-5-methyl-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl benzoate |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](COC(=O)c3ccccc3)N12 |
| InChI | InChI=1S/C30H33NO4/c1-22-17-18-26-28(33-19-23-11-5-2-6-12-23)29(34-20-24-13-7-3-8-14-24)27(31(22)26)21-35-30(32)25-15-9-4-10-16-25/h2-16,22,26-29H,17-21H2,1H3/t22-,26-,27+,28-,29-/m1/s1 |
| InChIKey | YEDDKIRNRQVUIB-PWWSGAPCSA-N |
| XLogP | 5.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |