C27H41NO5 — CID 42636501
(1S,8S,8aS)-8-hydroxy-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,5,8,8a-tetrahydro-1H-indolizin-3-one (PubChem CID 42636501) has the molecular formula C27H41NO5 and a molecular weight of 459.63 g/mol. Its IUPAC name is (1S,8S,8aS)-8-hydroxy-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,5,8,8a-tetrahydro-1H-indolizin-3-one.
| Compound Name | (1S,8S,8aS)-8-hydroxy-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,5,8,8a-tetrahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 42636501 |
| Molecular Formula | C27H41NO5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | (1S,8S,8aS)-8-hydroxy-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,5,8,8a-tetrahydro-1H-indolizin-3-one |
| SMILES | COCOC1=C[C@H](O)[C@H]2[C@@H](O[C@H](C)c3c(C(C)C)cc(C(C)C)cc3C(C)C)CC(=O)N2C1 |
| InChI | InChI=1S/C27H41NO5/c1-15(2)19-9-21(16(3)4)26(22(10-19)17(5)6)18(7)33-24-12-25(30)28-13-20(32-14-31-8)11-23(29)27(24)28/h9-11,15-18,23-24,27,29H,12-14H2,1-8H3/t18-,23+,24+,27+/m1/s1 |
| InChIKey | KEEYWVJACHAELD-YZHNWUKRSA-N |
| XLogP | 4.98 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|