C24H37NO3 — CID 42636499
(4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 42636499) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is (4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42636499 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | (4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | C=C[C@H](O)[C@@H]1NC(=O)C[C@@H]1O[C@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C24H37NO3/c1-9-20(26)24-21(12-22(27)25-24)28-16(8)23-18(14(4)5)10-17(13(2)3)11-19(23)15(6)7/h9-11,13-16,20-21,24,26H,1,12H2,2-8H3,(H,25,27)/t16-,20+,21+,24+/m1/s1 |
| InChIKey | VPKSQQIGLKHRRL-ZWBFNDLWSA-N |
| XLogP | 4.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|