C35H45FN2O3 — CID 67698849
4-[4-(4-fluorophenyl)-2-[(2S)-2-(phenylmethoxymethyl)hexyl]phenyl]-5-hydroxy-5-[(2S)-pyrrolidin-2-yl]pentanamide (PubChem CID 67698849) has the molecular formula C35H45FN2O3 and a molecular weight of 560.75 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-2-[(2S)-2-(phenylmethoxymethyl)hexyl]phenyl]-5-hydroxy-5-[(2S)-pyrrolidin-2-yl]pentanamide.
| Compound Name | 4-[4-(4-fluorophenyl)-2-[(2S)-2-(phenylmethoxymethyl)hexyl]phenyl]-5-hydroxy-5-[(2S)-pyrrolidin-2-yl]pentanamide |
|---|---|
| PubChem CID | 67698849 |
| Molecular Formula | C35H45FN2O3 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-2-[(2S)-2-(phenylmethoxymethyl)hexyl]phenyl]-5-hydroxy-5-[(2S)-pyrrolidin-2-yl]pentanamide |
| SMILES | CCCC[C@H](COCc1ccccc1)Cc1cc(-c2ccc(F)cc2)ccc1C(CCC(N)=O)C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C35H45FN2O3/c1-2-3-8-26(24-41-23-25-9-5-4-6-10-25)21-29-22-28(27-12-15-30(36)16-13-27)14-17-31(29)32(18-19-34(37)39)35(40)33-11-7-20-38-33/h4-6,9-10,12-17,22,26,32-33,35,38,40H,2-3,7-8,11,18-21,23-24H2,1H3,(H2,37,39)/t26-,32?,33-,35?/m0/s1 |
| InChIKey | MUHOVBZGVFWAEI-WUGZZFQWSA-N |
| XLogP | 6.52 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |