C29H45NO5 — CID 42636500
(4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 42636500) has the molecular formula C29H45NO5 and a molecular weight of 487.68 g/mol. Its IUPAC name is (4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42636500 |
| Molecular Formula | C29H45NO5 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | (4S,5S)-5-[(1S)-1-hydroxyprop-2-enyl]-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | C=C[C@H](O)[C@H]1[C@@H](O[C@H](C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC(=O)N1CC(=C)OCOC |
| InChI | InChI=1S/C29H45NO5/c1-11-25(31)29-26(14-27(32)30(29)15-20(8)34-16-33-10)35-21(9)28-23(18(4)5)12-22(17(2)3)13-24(28)19(6)7/h11-13,17-19,21,25-26,29,31H,1,8,14-16H2,2-7,9-10H3/t21-,25+,26+,29+/m1/s1 |
| InChIKey | CYIRJPMTIYRHNX-ULKKMRMTSA-N |
| XLogP | 5.78 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|