C36H61NO3Si — CID 101419342
(4R,5S)-1-prop-2-enyl-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one (PubChem CID 101419342) has the molecular formula C36H61NO3Si and a molecular weight of 583.97 g/mol. Its IUPAC name is (4R,5S)-1-prop-2-enyl-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one.
| Compound Name | (4R,5S)-1-prop-2-enyl-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 101419342 |
| Molecular Formula | C36H61NO3Si |
| Molecular Weight | 583.97 g/mol |
| Exact Mass | 583.44 |
| IUPAC Name | (4R,5S)-1-prop-2-enyl-4-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1R)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one |
| SMILES | C=CCN1C(=O)C[C@@H](OC(C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)[C@H]1[C@@H](C=C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H61NO3Si/c1-16-18-37-34(38)21-33(36(37)32(17-2)40-41(25(9)10,26(11)12)27(13)14)39-28(15)35-30(23(5)6)19-29(22(3)4)20-31(35)24(7)8/h16-17,19-20,22-28,32-33,36H,1-2,18,21H2,3-15H3/t28?,32-,33-,36-/m1/s1 |
| InChIKey | DUYZFLGZQMBLOO-OFDIJMKCSA-N |
| XLogP | 10.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.97 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|