C32H47NO5Si — CID 176878343
(4R)-4-benzyl-3-[(3R,5S,6S)-6-methyl-5-phenylmethoxy-3-triethylsilyloxyoctanoyl]-1,3-oxazolidin-2-one (PubChem CID 176878343) has the molecular formula C32H47NO5Si and a molecular weight of 553.82 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(3R,5S,6S)-6-methyl-5-phenylmethoxy-3-triethylsilyloxyoctanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(3R,5S,6S)-6-methyl-5-phenylmethoxy-3-triethylsilyloxyoctanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 176878343 |
| Molecular Formula | C32H47NO5Si |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | (4R)-4-benzyl-3-[(3R,5S,6S)-6-methyl-5-phenylmethoxy-3-triethylsilyloxyoctanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[C@H](C)[C@H](C[C@H](CC(=O)N1C(=O)OC[C@H]1Cc1ccccc1)O[Si](CC)(CC)CC)OCc1ccccc1 |
| InChI | InChI=1S/C32H47NO5Si/c1-6-25(5)30(36-23-27-18-14-11-15-19-27)21-29(38-39(7-2,8-3)9-4)22-31(34)33-28(24-37-32(33)35)20-26-16-12-10-13-17-26/h10-19,25,28-30H,6-9,20-24H2,1-5H3/t25-,28+,29+,30-/m0/s1 |
| InChIKey | FYYWXIFHDRXKMQ-XHDJHXHHSA-N |
| XLogP | 7.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|