C28H49NO5Si2 — CID 11060530
(4R)-4-benzyl-3-[(2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 11060530) has the molecular formula C28H49NO5Si2 and a molecular weight of 535.87 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11060530 |
| Molecular Formula | C28H49NO5Si2 |
| Molecular Weight | 535.87 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H49NO5Si2/c1-21(25(30)29-23(20-32-26(29)31)19-22-15-13-12-14-16-22)24(34-36(10,11)28(5,6)7)17-18-33-35(8,9)27(2,3)4/h12-16,21,23-24H,17-20H2,1-11H3/t21-,23-,24+/m1/s1 |
| InChIKey | BOCOGZQEYGWYNU-JRFVFWCSSA-N |
| XLogP | 7.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.87 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|