C25H36F3NO4Si — CID 135023007
(4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 135023007) has the molecular formula C25H36F3NO4Si and a molecular weight of 499.65 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135023007 |
| Molecular Formula | C25H36F3NO4Si |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](CC)C(F)(F)F |
| InChI | InChI=1S/C25H36F3NO4Si/c1-8-19(25(26,27)28)21(20(9-2)33-34(6,7)24(3,4)5)22(30)29-18(16-32-23(29)31)15-17-13-11-10-12-14-17/h9-14,18-21H,2,8,15-16H2,1,3-7H3/t18-,19+,20+,21-/m0/s1 |
| InChIKey | XKUOWBASJDBDGJ-BQJUDKOJSA-N |
| XLogP | 6.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|