C19H18F7NO4 — CID 102223810
(4S)-4-benzyl-3-[(2S)-4,4,5,5,6,6,6-heptafluoro-2-[(1R)-1-hydroxyprop-2-enyl]hexanoyl]-1,3-oxazolidin-2-one (PubChem CID 102223810) has the molecular formula C19H18F7NO4 and a molecular weight of 457.34 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-4,4,5,5,6,6,6-heptafluoro-2-[(1R)-1-hydroxyprop-2-enyl]hexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-4,4,5,5,6,6,6-heptafluoro-2-[(1R)-1-hydroxyprop-2-enyl]hexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102223810 |
| Molecular Formula | C19H18F7NO4 |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-4,4,5,5,6,6,6-heptafluoro-2-[(1R)-1-hydroxyprop-2-enyl]hexanoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O)[C@H](CC(F)(F)C(F)(F)C(F)(F)F)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H18F7NO4/c1-2-14(28)13(9-17(20,21)18(22,23)19(24,25)26)15(29)27-12(10-31-16(27)30)8-11-6-4-3-5-7-11/h2-7,12-14,28H,1,8-10H2/t12-,13-,14+/m0/s1 |
| InChIKey | LLYLRHRPGFSJCI-MELADBBJSA-N |
| XLogP | 3.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|