C16H14F7NO3 — CID 71477693
(4S)-4-benzyl-3-(4,4,5,5,6,6,6-heptafluorohexanoyl)-1,3-oxazolidin-2-one (PubChem CID 71477693) has the molecular formula C16H14F7NO3 and a molecular weight of 401.28 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(4,4,5,5,6,6,6-heptafluorohexanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(4,4,5,5,6,6,6-heptafluorohexanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71477693 |
| Molecular Formula | C16H14F7NO3 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (4S)-4-benzyl-3-(4,4,5,5,6,6,6-heptafluorohexanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)F)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H14F7NO3/c17-14(18,15(19,20)16(21,22)23)7-6-12(25)24-11(9-27-13(24)26)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2/t11-/m0/s1 |
| InChIKey | YQKRMWVDLLLMCK-NSHDSACASA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|