C19H23NO4 — CID 57395521
(4S)-3-(cyclopentanecarbonyl)-4-[(E,1R)-1-hydroxy-4-phenylbut-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 57395521) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (4S)-3-(cyclopentanecarbonyl)-4-[(E,1R)-1-hydroxy-4-phenylbut-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(cyclopentanecarbonyl)-4-[(E,1R)-1-hydroxy-4-phenylbut-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 57395521 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (4S)-3-(cyclopentanecarbonyl)-4-[(E,1R)-1-hydroxy-4-phenylbut-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H]([C@H](O)/C=C/Cc2ccccc2)N1C(=O)C1CCCC1 |
| InChI | InChI=1S/C19H23NO4/c21-17(12-6-9-14-7-2-1-3-8-14)16-13-24-19(23)20(16)18(22)15-10-4-5-11-15/h1-3,6-8,12,15-17,21H,4-5,9-11,13H2/b12-6+/t16-,17+/m0/s1 |
| InChIKey | ATBAPVONTRIEKJ-DBLLSSSKSA-N |
| XLogP | 2.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|