C19H22F3NO4 — CID 102223812
(4S)-4-benzyl-3-[(2S,3R)-3-hydroxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102223812) has the molecular formula C19H22F3NO4 and a molecular weight of 385.38 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R)-3-hydroxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R)-3-hydroxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102223812 |
| Molecular Formula | C19H22F3NO4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R)-3-hydroxy-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O)[C@@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](CC)C(F)(F)F |
| InChI | InChI=1S/C19H22F3NO4/c1-3-14(19(20,21)22)16(15(24)4-2)17(25)23-13(11-27-18(23)26)10-12-8-6-5-7-9-12/h4-9,13-16,24H,2-3,10-11H2,1H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | URRSMBLOVJNPCT-JJXSEGSLSA-N |
| XLogP | 3.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|