C18H20F3NO4 — CID 72547436
(4S)-4-benzyl-3-[(E,2S,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)hex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 72547436) has the molecular formula C18H20F3NO4 and a molecular weight of 371.36 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,2S,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)hex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,2S,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)hex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 72547436 |
| Molecular Formula | C18H20F3NO4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,2S,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)hex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/[C@@H](O)[C@H](CC(F)(F)F)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H20F3NO4/c1-2-6-15(23)14(10-18(19,20)21)16(24)22-13(11-26-17(22)25)9-12-7-4-3-5-8-12/h2-8,13-15,23H,9-11H2,1H3/b6-2+/t13-,14-,15+/m0/s1 |
| InChIKey | KOFWOCNCHVOFQK-NACBGRJTSA-N |
| XLogP | 3.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|