C23H32F3NO4Si — CID 135023031
(4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 135023031) has the molecular formula C23H32F3NO4Si and a molecular weight of 471.59 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135023031 |
| Molecular Formula | C23H32F3NO4Si |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(F)(F)F)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H32F3NO4Si/c1-7-19(31-32(5,6)22(2,3)4)18(14-23(24,25)26)20(28)27-17(15-30-21(27)29)13-16-11-9-8-10-12-16/h7-12,17-19H,1,13-15H2,2-6H3/t17-,18-,19+/m0/s1 |
| InChIKey | PYDYSLCPKXPJKQ-GBESFXJTSA-N |
| XLogP | 5.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|