C26H39NO5Si — CID 11454293
benzyl (1S,2R,5R,6S,8S,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-1-en-2-yl-10,11-dioxa-3-azatricyclo[6.2.1.02,6]undecane-3-carboxylate (PubChem CID 11454293) has the molecular formula C26H39NO5Si and a molecular weight of 473.69 g/mol. Its IUPAC name is benzyl (1S,2R,5R,6S,8S,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-1-en-2-yl-10,11-dioxa-3-azatricyclo[6.2.1.02,6]undecane-3-carboxylate.
| Compound Name | benzyl (1S,2R,5R,6S,8S,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-1-en-2-yl-10,11-dioxa-3-azatricyclo[6.2.1.02,6]undecane-3-carboxylate |
|---|---|
| PubChem CID | 11454293 |
| Molecular Formula | C26H39NO5Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | benzyl (1S,2R,5R,6S,8S,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-1-en-2-yl-10,11-dioxa-3-azatricyclo[6.2.1.02,6]undecane-3-carboxylate |
| SMILES | C=C(C)[C@@H]1CN(C(=O)OCc2ccccc2)[C@H]2[C@@H]3O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](C[C@H]21)O3 |
| InChI | InChI=1S/C26H39NO5Si/c1-17(2)20-14-27(25(28)29-15-18-11-9-8-10-12-18)23-19(20)13-21-22(32-24(23)31-21)16-30-33(6,7)26(3,4)5/h8-12,19-24H,1,13-16H2,2-7H3/t19-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | GNQHOWJKOQNRQY-OVUYMFTPSA-N |
| XLogP | 5.35 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|