C26H41NO6Si — CID 23247567
[(1S,2R,6R,7S,8aS)-7-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]methyl acetate (PubChem CID 23247567) has the molecular formula C26H41NO6Si and a molecular weight of 491.70 g/mol. Its IUPAC name is [(1S,2R,6R,7S,8aS)-7-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]methyl acetate.
| Compound Name | [(1S,2R,6R,7S,8aS)-7-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]methyl acetate |
|---|---|
| PubChem CID | 23247567 |
| Molecular Formula | C26H41NO6Si |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | [(1S,2R,6R,7S,8aS)-7-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CN2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc3ccccc3)[C@@H]2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H41NO6Si/c1-18(28)30-17-21-14-27-15-24(33-34(6,7)26(3,4)5)25(22(27)13-23(21)32-19(2)29)31-16-20-11-9-8-10-12-20/h8-12,21-25H,13-17H2,1-7H3/t21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | RROMZSVQMBGKCD-MQZWXTIWSA-N |
| XLogP | 4.16 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|