C23H33NO6 — CID 57199314
[(3aR,6S,7R,7aR)-7-acetyloxy-4-hexyl-3-hydroxy-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl] acetate (PubChem CID 57199314) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is [(3aR,6S,7R,7aR)-7-acetyloxy-4-hexyl-3-hydroxy-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl] acetate.
| Compound Name | [(3aR,6S,7R,7aR)-7-acetyloxy-4-hexyl-3-hydroxy-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl] acetate |
|---|---|
| PubChem CID | 57199314 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | [(3aR,6S,7R,7aR)-7-acetyloxy-4-hexyl-3-hydroxy-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl] acetate |
| SMILES | CCCCCCN1C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(c3ccccc3)C(O)[C@H]21 |
| InChI | InChI=1S/C23H33NO6/c1-4-5-6-10-13-24-14-18(28-15(2)25)22(29-16(3)26)23-19(24)20(27)21(30-23)17-11-8-7-9-12-17/h7-9,11-12,18-23,27H,4-6,10,13-14H2,1-3H3/t18-,19+,20?,21?,22+,23+/m0/s1 |
| InChIKey | RQRSVYAHERMZNP-MSZMKUEJSA-N |
| XLogP | 2.62 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|