C27H45NO5 — CID 42636503
(1S,6S,7S,8R,8aS)-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,3,5,6,7,8,8a-octahydroindolizine-7,8-diol (PubChem CID 42636503) has the molecular formula C27H45NO5 and a molecular weight of 463.66 g/mol. Its IUPAC name is (1S,6S,7S,8R,8aS)-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,3,5,6,7,8,8a-octahydroindolizine-7,8-diol.
| Compound Name | (1S,6S,7S,8R,8aS)-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,3,5,6,7,8,8a-octahydroindolizine-7,8-diol |
|---|---|
| PubChem CID | 42636503 |
| Molecular Formula | C27H45NO5 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | (1S,6S,7S,8R,8aS)-6-(methoxymethoxy)-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-1,2,3,5,6,7,8,8a-octahydroindolizine-7,8-diol |
| SMILES | COCO[C@H]1CN2CC[C@H](O[C@H](C)c3c(C(C)C)cc(C(C)C)cc3C(C)C)[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H45NO5/c1-15(2)19-11-20(16(3)4)24(21(12-19)17(5)6)18(7)33-22-9-10-28-13-23(32-14-31-8)26(29)27(30)25(22)28/h11-12,15-18,22-23,25-27,29-30H,9-10,13-14H2,1-8H3/t18-,22+,23+,25-,26-,27-/m1/s1 |
| InChIKey | NROWJYSFNLQWPD-FUWDCPPJSA-N |
| XLogP | 4.30 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|