C16H22FNO2 — CID 106881117
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-fluoro-4,6-dimethylphenyl)methanol (PubChem CID 106881117) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-fluoro-4,6-dimethylphenyl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-fluoro-4,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 106881117 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-fluoro-4,6-dimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)C2CN3CCCC3CO2)c(F)c1 |
| InChI | InChI=1S/C16H22FNO2/c1-10-6-11(2)15(13(17)7-10)16(19)14-8-18-5-3-4-12(18)9-20-14/h6-7,12,14,16,19H,3-5,8-9H2,1-2H3 |
| InChIKey | VQRYGMVHPVKGGZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |