C25H36F3NO4Si — CID 101074076
N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzyl-2,2,2-trifluoroacetamide (PubChem CID 101074076) has the molecular formula C25H36F3NO4Si and a molecular weight of 499.65 g/mol. Its IUPAC name is N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzyl-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzyl-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101074076 |
| Molecular Formula | C25H36F3NO4Si |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzyl-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@H]2[C@H](C=CCC(N(Cc3ccccc3)C(=O)C(F)(F)F)[C@@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H36F3NO4Si/c1-23(2,3)34(6,7)33-20-18(14-11-15-19-21(20)32-24(4,5)31-19)29(22(30)25(26,27)28)16-17-12-9-8-10-13-17/h8-13,15,18-21H,14,16H2,1-7H3/t18?,19-,20-,21-/m0/s1 |
| InChIKey | ODMWVMPUNGVSML-KTYMLHDXSA-N |
| XLogP | 5.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|