C25H39NO4Si — CID 11374226
N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzylacetamide (PubChem CID 11374226) has the molecular formula C25H39NO4Si and a molecular weight of 445.68 g/mol. Its IUPAC name is N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzylacetamide.
| Compound Name | N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 11374226 |
| Molecular Formula | C25H39NO4Si |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[(3aS,4S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-yl]-N-benzylacetamide |
| SMILES | CC(=O)N(Cc1ccccc1)C1CC=C[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39NO4Si/c1-18(27)26(17-19-13-10-9-11-14-19)20-15-12-16-21-23(29-25(5,6)28-21)22(20)30-31(7,8)24(2,3)4/h9-14,16,20-23H,15,17H2,1-8H3/t20?,21-,22-,23-/m0/s1 |
| InChIKey | LAMYLINEFHPYFL-KVROEHFOSA-N |
| XLogP | 5.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|