C25H41NO3Si — CID 11407802
(1S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-amine (PubChem CID 11407802) has the molecular formula C25H41NO3Si and a molecular weight of 431.69 g/mol. Its IUPAC name is (1S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-amine.
| Compound Name | (1S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 11407802 |
| Molecular Formula | C25H41NO3Si |
| Molecular Weight | 431.69 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (1S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-amine |
| SMILES | C=CCC(NCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C25H41NO3Si/c1-10-15-20(26-18-19-16-13-12-14-17-19)22(29-30(8,9)24(3,4)5)23-21(11-2)27-25(6,7)28-23/h10-14,16-17,20-23,26H,1-2,15,18H2,3-9H3/t20?,21-,22-,23-/m0/s1 |
| InChIKey | FMPUDEURNDYVBR-KVROEHFOSA-N |
| XLogP | 5.82 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|