C17H25NO2 — CID 56651053
(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-3-en-1-amine (PubChem CID 56651053) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-3-en-1-amine.
| Compound Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 56651053 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]but-3-en-1-amine |
| SMILES | C=CC[C@@H](N[C@@H](C)c1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H25NO2/c1-5-9-15(16-12-19-17(3,4)20-16)18-13(2)14-10-7-6-8-11-14/h5-8,10-11,13,15-16,18H,1,9,12H2,2-4H3/t13-,15+,16+/m0/s1 |
| InChIKey | AXXSMDBFHYIFRQ-NUEKZKHPSA-N |
| XLogP | 3.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|