C26H43NO4Si — CID 56653956
tert-butyl N-benzyl-N-[(3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxypent-1-en-3-yl]carbamate (PubChem CID 56653956) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxypent-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxypent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 56653956 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | tert-butyl N-benzyl-N-[(3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-prop-2-enoxypent-1-en-3-yl]carbamate |
| SMILES | C=CCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](C=C)N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43NO4Si/c1-11-18-29-23(20-30-32(9,10)26(6,7)8)22(12-2)27(24(28)31-25(3,4)5)19-21-16-14-13-15-17-21/h11-17,22-23H,1-2,18-20H2,3-10H3/t22-,23+/m0/s1 |
| InChIKey | TWVLNVVCHARBBY-XZOQPEGZSA-N |
| XLogP | 6.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|