C24H39NO4Si — CID 134962337
tert-butyl (2S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 134962337) has the molecular formula C24H39NO4Si and a molecular weight of 433.67 g/mol. Its IUPAC name is tert-butyl (2S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 134962337 |
| Molecular Formula | C24H39NO4Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl (2S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(phenylmethoxymethyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CO[Si](C)(C)C(C)(C)C)=C[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C24H39NO4Si/c1-23(2,3)29-22(26)25-15-20(17-28-30(7,8)24(4,5)6)14-21(25)18-27-16-19-12-10-9-11-13-19/h9-14,21H,15-18H2,1-8H3/t21-/m0/s1 |
| InChIKey | FDMXCAYLSPNYBV-NRFANRHFSA-N |
| XLogP | 5.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|